CAS 35985-70-7 appears in our catalog under these names: 2-[(4-Fluorophenyl)sulfanyl]-5-nitrobenzenecarbaldehyde, 95%, 2-(4-Fluorophenylthio)-5-nitrobenzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-fluorophenyl)sulfanyl-5-nitrobenzaldehyde (CAS 35985-70-7) is a chemical compound with the molecular formula C13H8FNO3S and a molecular weight of 277.27 g/mol. IUPAC name: 2-(4-fluorophenyl)sulfanyl-5-nitrobenzaldehyde. InChIKey: HZYUWCHYUSOBOT-UHFFFAOYSA-N.
| Molecular formula | C13H8FNO3S |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | 2-(4-fluorophenyl)sulfanyl-5-nitrobenzaldehyde |
| InChIKey | HZYUWCHYUSOBOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)SC2=C(C=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)