Products 35986-44-8
CAS 35986-44-8 is the registry number for Ionone Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
(4Z)-4-(2,2-dimethyl-6-methylidenecyclohexylidene)butan-2-one (CAS 35986-44-8) is a chemical compound with the molecular formula C13H20O and a molecular weight of 192.30 g/mol. IUPAC name: (4Z)-4-(2,2-dimethyl-6-methylidenecyclohexylidene)butan-2-one. InChIKey: STMGHGYQYPUFRG-XYOKQWHBSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | (4Z)-4-(2,2-dimethyl-6-methylidenecyclohexylidene)butan-2-one |
| InChIKey | STMGHGYQYPUFRG-XYOKQWHBSA-N |
| SMILES | CC(=O)C/C=C/1\C(=C)CCCC1(C)C |
Computed by PubChem (NCBI)