CAS 3599-17-5 is the registry number for Genisteine Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
(1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydrochloride (CAS 3599-17-5) is a chemical compound with the molecular formula C15H27ClN2 and a molecular weight of 270.84 g/mol. IUPAC name: (1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydrochloride. InChIKey: RMSLOXMMNWLOAB-FFIJQSHZSA-N.
| Molecular formula | C15H27ClN2 |
|---|---|
| Molecular weight | 270.84 g/mol |
| IUPAC name | (1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydrochloride |
| InChIKey | RMSLOXMMNWLOAB-FFIJQSHZSA-N |
| SMILES | C1CCN2C[C@@H]3C[C@H]([C@H]2C1)CN4[C@@H]3CCCC4.Cl |
Computed by PubChem (NCBI)