CAS 3599-58-4 is the registry number for 2,4-D Ethanolammonium Salt. Offered by: TRC. Available pack sizes: 2,5g.
2-(2,4-dichlorophenoxy)acetate;2-hydroxyethylazanium (CAS 3599-58-4) is a chemical compound with the molecular formula C10H13Cl2NO4 and a molecular weight of 282.12 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)acetate;2-hydroxyethylazanium. InChIKey: LWEGPOVUIQAHBP-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO4 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)acetate;2-hydroxyethylazanium |
| InChIKey | LWEGPOVUIQAHBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)[O-].C(CO)[NH3+] |
Computed by PubChem (NCBI)