CAS 360-43-0 is the registry number for N,N'-(Ethane-1,2-diyl)bis(2,2,2-trifluoroacetamide), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]acetamide (CAS 360-43-0) is a chemical compound with the molecular formula C6H6F6N2O2 and a molecular weight of 252.11 g/mol. IUPAC name: 2,2,2-trifluoro-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]acetamide. InChIKey: BSMXDULOVFUYER-UHFFFAOYSA-N.
| Molecular formula | C6H6F6N2O2 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]acetamide |
| InChIKey | BSMXDULOVFUYER-UHFFFAOYSA-N |
| SMILES | C(CNC(=O)C(F)(F)F)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)