CAS 36001-88-4 appears in our catalog under these names: Amiprofos-methyl, >95% (HPLC), Amiprofos-methyl, Amiprofos–methyl, Amiprofos-methyl, >95.0%(HPLC)(T)(qNMR), Amiprofos methyl. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 500mg, 50mg, 10mg, 25mg, 5mg, 50 mg.
N-[methoxy-(4-methyl-2-nitrophenoxy)phosphinothioyl]propan-2-amine (CAS 36001-88-4) is a chemical compound with the molecular formula C11H17N2O4PS and a molecular weight of 304.30 g/mol. IUPAC name: N-[methoxy-(4-methyl-2-nitrophenoxy)phosphinothioyl]propan-2-amine. InChIKey: VHEWQRWLIDWRMR-UHFFFAOYSA-N.
| Molecular formula | C11H17N2O4PS |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | N-[methoxy-(4-methyl-2-nitrophenoxy)phosphinothioyl]propan-2-amine |
| InChIKey | VHEWQRWLIDWRMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OP(=S)(NC(C)C)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)