Products 360053-41-4

CAS 360053-41-4 appears in our catalog under these names: 2,5-Bis(((trans-4-pentylcyclohexyl)carbonyl)oxy)benzoic acid, 95%, 2,5-Bis[[(trans-4-pentylcyclohexyl)carbonyl]oxy]benzoic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg, 500mg.

2,5-bis[(4-pentylcyclohexanecarbonyl)oxy]benzoic acid (CAS 360053-41-4) is a chemical compound with the molecular formula C31H46O6 and a molecular weight of 514.7 g/mol. IUPAC name: 2,5-bis[(4-pentylcyclohexanecarbonyl)oxy]benzoic acid. InChIKey: LWNPBGLLPFYOPY-UHFFFAOYSA-N.

Identity
Molecular formulaC31H46O6
Molecular weight514.7 g/mol
IUPAC name2,5-bis[(4-pentylcyclohexanecarbonyl)oxy]benzoic acid
InChIKeyLWNPBGLLPFYOPY-UHFFFAOYSA-N
SMILESCCCCCC1CCC(CC1)C(=O)OC2=CC(=C(C=C2)OC(=O)C3CCC(CC3)CCCCC)C(=O)O

Computed by PubChem (NCBI)