CAS 3607-17-8 appears in our catalog under these names: Olopatadine Impurity 7, (3-Bromopropyl)triphenylphosphonium Bromide, (3–Bromopropyl)triphenylphosphonium bromide, 3-Bromopropyltriphenylphosphonium Bromide, >98.0%(HPLC)(T), 3-Bromopropyltriphenylphosphonium Bromide 97%. Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 25g, 50g, 5g, 100g, 500g, 10g, 1000g.
3-bromopropyl(triphenyl)phosphanium bromide (CAS 3607-17-8) is a chemical compound with the molecular formula C21H21Br2P and a molecular weight of 464.2 g/mol. IUPAC name: 3-bromopropyl(triphenyl)phosphanium bromide. InChIKey: ZAHUZZUGJRPGKW-UHFFFAOYSA-M.
| Molecular formula | C21H21Br2P |
|---|---|
| Molecular weight | 464.2 g/mol |
| IUPAC name | 3-bromopropyl(triphenyl)phosphanium bromide |
| InChIKey | ZAHUZZUGJRPGKW-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CCCBr)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)