CAS 360760-58-3 is the registry number for EG31. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3,5-bis(6-bromo-4-oxo-3,1-benzoxazin-2-yl)phenyl]isoindole-1,3-dione (CAS 360760-58-3) is a chemical compound with the molecular formula C30H13Br2N3O6 and a molecular weight of 671.2 g/mol. IUPAC name: 2-[3,5-bis(6-bromo-4-oxo-3,1-benzoxazin-2-yl)phenyl]isoindole-1,3-dione. InChIKey: TVVJGKKUNWGZPK-UHFFFAOYSA-N.
| Molecular formula | C30H13Br2N3O6 |
|---|---|
| Molecular weight | 671.2 g/mol |
| IUPAC name | 2-[3,5-bis(6-bromo-4-oxo-3,1-benzoxazin-2-yl)phenyl]isoindole-1,3-dione |
| InChIKey | TVVJGKKUNWGZPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC(=CC(=C3)C4=NC5=C(C=C(C=C5)Br)C(=O)O4)C6=NC7=C(C=C(C=C7)Br)C(=O)O6 |
Computed by PubChem (NCBI)