CAS 36093-47-7 appears in our catalog under these names: Salantel, Salantel, Concentration: 100 µg/ml Solvent: Acetonitrile, Salantel-d4. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 250mg, 1x10mg, 1x1ml.
N-[3-chloro-4-(4-chlorobenzoyl)phenyl]-2-hydroxy-3,5-diiodobenzamide (CAS 36093-47-7) is a chemical compound with the molecular formula C20H11Cl2I2NO3 and a molecular weight of 638.0 g/mol. IUPAC name: N-[3-chloro-4-(4-chlorobenzoyl)phenyl]-2-hydroxy-3,5-diiodobenzamide. InChIKey: IYOGQJKSVBNXBF-UHFFFAOYSA-N.
| Molecular formula | C20H11Cl2I2NO3 |
|---|---|
| Molecular weight | 638.0 g/mol |
| IUPAC name | N-[3-chloro-4-(4-chlorobenzoyl)phenyl]-2-hydroxy-3,5-diiodobenzamide |
| InChIKey | IYOGQJKSVBNXBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)NC(=O)C3=C(C(=CC(=C3)I)I)O)Cl)Cl |
Computed by PubChem (NCBI)