CAS 36098-33-6 appears in our catalog under these names: F16, F16/ 99.66% (existing batch purity), F16, 98.0%, 98.0%, F16, 99.94%, F16 (Standard). Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 10 mg.
3-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-1H-indole iodide (CAS 36098-33-6) is a chemical compound with the molecular formula C16H15IN2 and a molecular weight of 362.21 g/mol. IUPAC name: 3-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-1H-indole iodide. InChIKey: UURAKYSOOXPORG-UHFFFAOYSA-N.
| Molecular formula | C16H15IN2 |
|---|---|
| Molecular weight | 362.21 g/mol |
| IUPAC name | 3-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-1H-indole iodide |
| InChIKey | UURAKYSOOXPORG-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=C(C=C1)/C=C/C2=CNC3=CC=CC=C32.[I-] |
Computed by PubChem (NCBI)