Products 361203-06-7
CAS 361203-06-7 is the registry number for GW7604, 98.0%. Offered by: MedChemExpress, Chemat. Available pack sizes: 10 mg, 10mM/1mL, 5 mg, 1mg, 5mg.
(E)-3-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid (CAS 361203-06-7) is a chemical compound with the molecular formula C25H22O3 and a molecular weight of 370.4 g/mol. IUPAC name: (E)-3-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid. InChIKey: SCVIEONTACSLJA-VZBZSUMNSA-N.
| Molecular formula | C25H22O3 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (E)-3-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
| InChIKey | SCVIEONTACSLJA-VZBZSUMNSA-N |
| SMILES | CC/C(=C(\C1=CC=C(C=C1)/C=C/C(=O)O)/C2=CC=C(C=C2)O)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)