CAS 361382-26-5 appears in our catalog under these names: Bilastine Impurity 20, Bilastine impurity B. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]ethanol (CAS 361382-26-5) is a chemical compound with the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. IUPAC name: 2-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]ethanol. InChIKey: XJZPZWCCWIEQRR-UHFFFAOYSA-N.
| Molecular formula | C16H23NO2 |
|---|---|
| Molecular weight | 261.36 g/mol |
| IUPAC name | 2-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]ethanol |
| InChIKey | XJZPZWCCWIEQRR-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C(C)(C)C2=CC=C(C=C2)CCO)C |
Computed by PubChem (NCBI)