CAS 3614-30-0 appears in our catalog under these names: Emepronium Bromide, >95% (HPLC), Emepronium Bromide. Offered by: TRC, LoGiCal, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 2mg, 25mg, 50mg.
4,4-diphenylbutan-2-yl-ethyl-dimethylazanium bromide (CAS 3614-30-0) is a chemical compound with the molecular formula C20H28BrN and a molecular weight of 362.3 g/mol. IUPAC name: 4,4-diphenylbutan-2-yl-ethyl-dimethylazanium bromide. InChIKey: UVKFSMBPRQBNCH-UHFFFAOYSA-M.
| Molecular formula | C20H28BrN |
|---|---|
| Molecular weight | 362.3 g/mol |
| IUPAC name | 4,4-diphenylbutan-2-yl-ethyl-dimethylazanium bromide |
| InChIKey | UVKFSMBPRQBNCH-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(C)C(C)CC(C1=CC=CC=C1)C2=CC=CC=C2.[Br-] |
Computed by PubChem (NCBI)