Products 361436-29-5
CAS 361436-29-5 appears in our catalog under these names: N,N-Di-(tert-Butyloxycarbonyl) Serotonin, >95% (HPLC), N,N-Di-(tert-butyloxycarbonyl) serotonin. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1g.
Tert-butyl 5-hydroxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]indole-1-carboxylate (CAS 361436-29-5) is a chemical compound with the molecular formula C20H28N2O5 and a molecular weight of 376.4 g/mol. IUPAC name: tert-butyl 5-hydroxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]indole-1-carboxylate. InChIKey: OIDYOEXQSBWWOC-UHFFFAOYSA-N.
| Molecular formula | C20H28N2O5 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | tert-butyl 5-hydroxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]indole-1-carboxylate |
| InChIKey | OIDYOEXQSBWWOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC1=CN(C2=C1C=C(C=C2)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)