CAS 361441-98-7 appears in our catalog under these names: Saxagliptin Impurity 24, 3-Deoxy Saxagliptin, Saxagliptin Impurity 8. Offered by: Hubei YoungXin, TRC, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
(1S,3S,5S)-2-[(2S)-2-(1-adamantyl)-2-aminoacetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile (CAS 361441-98-7) is a chemical compound with the molecular formula C18H25N3O and a molecular weight of 299.4 g/mol. IUPAC name: (1S,3S,5S)-2-[(2S)-2-(1-adamantyl)-2-aminoacetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile. InChIKey: CNEBXOWFQASQAR-FTDXYOEWSA-N.
| Molecular formula | C18H25N3O |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (1S,3S,5S)-2-[(2S)-2-(1-adamantyl)-2-aminoacetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
| InChIKey | CNEBXOWFQASQAR-FTDXYOEWSA-N |
| SMILES | C1[C@@H]2C[C@@H]2N([C@@H]1C#N)C(=O)[C@H](C34CC5CC(C3)CC(C5)C4)N |
Computed by PubChem (NCBI)