CAS 36148-89-7 appears in our catalog under these names: Amphotericin B Methyl Ester, Amphotericin B Methyl Ester 90%, Amphotericin B Methyl Ester (>80%), Amphotericin B methyl ester, Amphotericin B methyl ester, 80%, 80%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1g, 5mg, 10mg, 25mg, 50mg, 2mg.
Amphotericin B methyl ester is the methyl ester of amphotericin B. It has a role as a metabolite, an antiinfective agent and an antifungal agent. It is a macrolide, a methyl ester and a monosaccharide derivative. It is functionally related to an amphotericin B.
Source: ChEBI
| Molecular formula | C48H75NO17 |
|---|---|
| Molecular weight | 938.1 g/mol |
| IUPAC name | methyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylate |
| InChIKey | UAZIZEMIKKIBCA-TYVGYKFWSA-N |
| SMILES | C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)OC)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O |
Computed by PubChem (NCBI)