CAS 3615-82-5 appears in our catalog under these names: Calcium Phytate, 98%, Calcium Phytate, Calcium-magnesium phytate, Phytin, Phytin, 98%, 98%. Offered by: AmBeed, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1kg, 0,5kg, 25g, 500g, 2kg.
Calcium;magnesium;(2,3,4,5,6-pentaphosphonatooxycyclohexyl) phosphate (CAS 3615-82-5) is a chemical compound with the molecular formula C6H6CaMgO24P6-8 and a molecular weight of 712.32 g/mol. IUPAC name: calcium;magnesium;(2,3,4,5,6-pentaphosphonatooxycyclohexyl) phosphate. InChIKey: JWJNVODPOMYTLT-UHFFFAOYSA-B.
| Molecular formula | C6H6CaMgO24P6-8 |
|---|---|
| Molecular weight | 712.32 g/mol |
| IUPAC name | calcium;magnesium;(2,3,4,5,6-pentaphosphonatooxycyclohexyl) phosphate |
| InChIKey | JWJNVODPOMYTLT-UHFFFAOYSA-B |
| SMILES | C1(C(C(C(C(C1OP(=O)([O-])[O-])OP(=O)([O-])[O-])OP(=O)([O-])[O-])OP(=O)([O-])[O-])OP(=O)([O-])[O-])OP(=O)([O-])[O-].[Mg+2].[Ca+2] |
Computed by PubChem (NCBI)