CAS 36167-63-2 appears in our catalog under these names: Halofantrine hydrochloride, 95%, Halofantrine Hydrochloride, >95% (HPLC), Halofantrine Hydrochloride, Halofantrine hydrochloride (SKF–102886), Halofantrine HCl 98+%. Offered by: Combi-blocks, TRC, Mikromol, LoGiCal, GLPBio. Available pack sizes: 100mg, 10mg, 5mg, 1mg, 10mM (in 1ml dmso), 25mg, 50mg, Get quote.
3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propan-1-ol;hydrochloride (CAS 36167-63-2) is a chemical compound with the molecular formula C26H31Cl3F3NO and a molecular weight of 536.9 g/mol. IUPAC name: 3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propan-1-ol;hydrochloride. InChIKey: WANGFTDWOFGECH-UHFFFAOYSA-N.
| Molecular formula | C26H31Cl3F3NO |
|---|---|
| Molecular weight | 536.9 g/mol |
| IUPAC name | 3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propan-1-ol;hydrochloride |
| InChIKey | WANGFTDWOFGECH-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCC(C1=C2C=CC(=CC2=C3C=C(C=C(C3=C1)Cl)Cl)C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)