CAS 36170-34-0 appears in our catalog under these names: Barium cis-epoxy-succinate, 98%, Barium cis-epoxy-Succinate, >95% (HPLC), Barium cis-epoxy-succinate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 1g, 2g, 500mg, 1000mg, 2000mg, 5000mg, 10000mg.
Barium(2+);(2R,3S)-oxirane-2,3-dicarboxylate (CAS 36170-34-0) is a chemical compound with the molecular formula C4H2BaO5 and a molecular weight of 267.38 g/mol. IUPAC name: barium(2+);(2R,3S)-oxirane-2,3-dicarboxylate. InChIKey: OCTAFAUQSARSPC-NUGIMEKKSA-L.
| Molecular formula | C4H2BaO5 |
|---|---|
| Molecular weight | 267.38 g/mol |
| IUPAC name | barium(2+);(2R,3S)-oxirane-2,3-dicarboxylate |
| InChIKey | OCTAFAUQSARSPC-NUGIMEKKSA-L |
| SMILES | [C@@H]1([C@H](O1)C(=O)[O-])C(=O)[O-].[Ba+2] |
Computed by PubChem (NCBI)