CAS 36175-10-7 is the registry number for Picosulfate Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium [4-[(4-acetyloxyphenyl)-pyridin-2-ylmethyl]phenyl] sulfate (CAS 36175-10-7) is a chemical compound with the molecular formula C20H16NNaO6S and a molecular weight of 421.4 g/mol. IUPAC name: sodium [4-[(4-acetyloxyphenyl)-pyridin-2-ylmethyl]phenyl] sulfate. InChIKey: CCPXHAOBBHFPOZ-UHFFFAOYSA-M.
| Molecular formula | C20H16NNaO6S |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | sodium [4-[(4-acetyloxyphenyl)-pyridin-2-ylmethyl]phenyl] sulfate |
| InChIKey | CCPXHAOBBHFPOZ-UHFFFAOYSA-M |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(C2=CC=C(C=C2)OS(=O)(=O)[O-])C3=CC=CC=N3.[Na+] |
Computed by PubChem (NCBI)