CAS 362049-63-6 appears in our catalog under these names: Ethylene-d4 Carbonate, 99 atom % D, min 98% Chemical Purity, Ethylene carbonate–d4, ETHYLENE-D4 CARBONATE, 98 ATOM % D(99%&, Ethylene carbonate-d4, 99.19%. Offered by: CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100mg, 1G, 5G, 10 mg, 50 mg, 100 mg.
4,4,5,5-tetradeuterio-1,3-dioxolan-2-one (CAS 362049-63-6) is a chemical compound with the molecular formula C3H4O3 and a molecular weight of 92.09 g/mol. IUPAC name: 4,4,5,5-tetradeuterio-1,3-dioxolan-2-one. InChIKey: KMTRUDSVKNLOMY-LNLMKGTHSA-N.
| Molecular formula | C3H4O3 |
|---|---|
| Molecular weight | 92.09 g/mol |
| IUPAC name | 4,4,5,5-tetradeuterio-1,3-dioxolan-2-one |
| InChIKey | KMTRUDSVKNLOMY-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(OC(=O)O1)([2H])[2H])[2H] |
Computed by PubChem (NCBI)