CAS 36238-64-9 appears in our catalog under these names: Cyclo(-d-ala-l-pro), 95%, Cyclo(D-Ala-L-Pro), 97%, Cyclo(D–Ala–L–Pro), (3R,8aS)-3-methylhexahydropyrrolo[1,2-a]pyrazine-1,4-dione, 95%, 95%, Cyclo(D-Ala-L-Pro). Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 5g, 1g, 25mg, 5mg, 5 mg.
(3R,8aS)-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 36238-64-9) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: (3R,8aS)-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: WSLYCILIEOFQPK-RITPCOANSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (3R,8aS)-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | WSLYCILIEOFQPK-RITPCOANSA-N |
| SMILES | C[C@@H]1C(=O)N2CCC[C@H]2C(=O)N1 |
Computed by PubChem (NCBI)