CAS 362595-93-5 is the registry number for 4'-(4-Dimethylaminophenyl)-2,2':6',2''-terpyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-(2,6-dipyridin-2-yl-4-pyridinyl)-N,N-dimethylaniline (CAS 362595-93-5) is a chemical compound with the molecular formula C23H20N4 and a molecular weight of 352.4 g/mol. IUPAC name: 4-(2,6-dipyridin-2-yl-4-pyridinyl)-N,N-dimethylaniline. InChIKey: PPTBTZUMFUTBOK-UHFFFAOYSA-N.
| Molecular formula | C23H20N4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 4-(2,6-dipyridin-2-yl-4-pyridinyl)-N,N-dimethylaniline |
| InChIKey | PPTBTZUMFUTBOK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4 |
Computed by PubChem (NCBI)