CAS 3627-04-1 appears in our catalog under these names: 5-(4-Diethylamino-2-hydroxyphenylazo)-4-hydroxynaphthalene-2,7-disulfonic acid sodium salt, 95%, BERYLLON III, Beryllon III. Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 5g, 1g.
4-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (CAS 3627-04-1) is a chemical compound with the molecular formula C20H21N3O8S2 and a molecular weight of 495.5 g/mol. IUPAC name: 4-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid. InChIKey: LDQGUZFHJKOWGX-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O8S2 |
|---|---|
| Molecular weight | 495.5 g/mol |
| IUPAC name | 4-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| InChIKey | LDQGUZFHJKOWGX-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N=NC2=C3C(=CC(=C2)S(=O)(=O)O)C=C(C=C3O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)