CAS 362718-79-4 appears in our catalog under these names: 1,1,1,3,3,3-Hexafluoro-2-(1,3-thiazol-2-yl)propan-2-ol, 95%, 1,1,1,3,3,3-Hexafluoro-2-(1,3-thiazol-2-yl)propan-2-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-yl)propan-2-ol (CAS 362718-79-4) is a chemical compound with the molecular formula C6H3F6NOS and a molecular weight of 251.15 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-yl)propan-2-ol. InChIKey: YFNPVQDQULAPPS-UHFFFAOYSA-N.
| Molecular formula | C6H3F6NOS |
|---|---|
| Molecular weight | 251.15 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-yl)propan-2-ol |
| InChIKey | YFNPVQDQULAPPS-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)