CAS 36273-97-9 is the registry number for 2-Amino-4λâµ-(1,2,4)thiadiazolo(2,3-a)pyridin-4-ylium chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[1,2,4]thiadiazolo[2,3-a]pyridin-4-ium-2-amine chloride (CAS 36273-97-9) is a chemical compound with the molecular formula C6H6ClN3S and a molecular weight of 187.65 g/mol. IUPAC name: [1,2,4]thiadiazolo[2,3-a]pyridin-4-ium-2-amine chloride. InChIKey: LUQMWCGRINTRPQ-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3S |
|---|---|
| Molecular weight | 187.65 g/mol |
| IUPAC name | [1,2,4]thiadiazolo[2,3-a]pyridin-4-ium-2-amine chloride |
| InChIKey | LUQMWCGRINTRPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=[N+]2C(=C1)N=C(S2)N.[Cl-] |
Computed by PubChem (NCBI)