Products 36277-38-0
CAS 36277-38-0 is the registry number for (1S,6R)-8,8-Dimethylbicyclo(4.2.0)octan-7-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,6R)-8,8-dimethylbicyclo[4.2.0]octan-7-one (CAS 36277-38-0) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1S,6R)-8,8-dimethylbicyclo[4.2.0]octan-7-one. InChIKey: UCKQUWDHMIIOJY-SFYZADRCSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1S,6R)-8,8-dimethylbicyclo[4.2.0]octan-7-one |
| InChIKey | UCKQUWDHMIIOJY-SFYZADRCSA-N |
| SMILES | CC1([C@H]2CCCC[C@H]2C1=O)C |
Computed by PubChem (NCBI)