CAS 36282-40-3 appears in our catalog under these names: 3–Methoxyphenylmagnesium bromide, 3-METHOXYPHENYLMAGNESIUM BROMIDE, 1.0M S, 3-Methoxyphenylmagnesium bromide, 1.0 M in 2-MeTHF . Offered by: GLPBio, Sigma-Aldrich, Thermo Scientific (Alfa Aesar). Available pack sizes: 100ml, 1l, 500ml.
Magnesium;methoxybenzene;bromide (CAS 36282-40-3) is a chemical compound with the molecular formula C7H7BrMgO and a molecular weight of 211.34 g/mol. IUPAC name: magnesium;methoxybenzene;bromide. InChIKey: FKUUDDGRDRPAQQ-UHFFFAOYSA-M.
| Molecular formula | C7H7BrMgO |
|---|---|
| Molecular weight | 211.34 g/mol |
| IUPAC name | magnesium;methoxybenzene;bromide |
| InChIKey | FKUUDDGRDRPAQQ-UHFFFAOYSA-M |
| SMILES | COC1=CC=C[C-]=C1.[Mg+2].[Br-] |
Computed by PubChem (NCBI)