CAS 36288-37-6 is the registry number for N-Hydroxy-4-methylbenzimidoyl Chloride. Offered by: TRC. Available pack sizes: 750mg.
(1Z)-N-hydroxy-4-methylbenzenecarboximidoyl chloride (CAS 36288-37-6) is a chemical compound with the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. IUPAC name: (1Z)-N-hydroxy-4-methylbenzenecarboximidoyl chloride. InChIKey: CWLYVEMDVAPUMV-NTMALXAHSA-N.
| Molecular formula | C8H8ClNO |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (1Z)-N-hydroxy-4-methylbenzenecarboximidoyl chloride |
| InChIKey | CWLYVEMDVAPUMV-NTMALXAHSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=N/O)/Cl |
Computed by PubChem (NCBI)