Products 36290-94-5
CAS 36290-94-5 appears in our catalog under these names: PolystyreneIodosoacetate, Poly[4-(diacetoxyiodo)styrene], Polystyrene Iodosoacetate. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g.
[acetyloxy-(4-ethenylphenyl)-lambda3-iodanyl] acetate;azane (CAS 36290-94-5) is a chemical compound with the molecular formula C12H16INO4 and a molecular weight of 365.16 g/mol. IUPAC name: [acetyloxy-(4-ethenylphenyl)-lambda3-iodanyl] acetate;azane. InChIKey: GFGTWSIVNCQXQL-UHFFFAOYSA-N.
| Molecular formula | C12H16INO4 |
|---|---|
| Molecular weight | 365.16 g/mol |
| IUPAC name | [acetyloxy-(4-ethenylphenyl)-lambda3-iodanyl] acetate;azane |
| InChIKey | GFGTWSIVNCQXQL-UHFFFAOYSA-N |
| SMILES | CC(=O)OI(C1=CC=C(C=C1)C=C)OC(=O)C.N |
Computed by PubChem (NCBI)