CAS 1427311-76-9 appears in our catalog under these names: (S)-1-(4-Iodo-5-methoxy-2-nitrophenyl)-2,2-dimethylpropan-1-ol, 95%, (S)–1–(4–Iodo–5–methoxy–2–nitrophenyl)–2,2–dimethylpropan–1–ol. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(1S)-1-(4-iodo-5-methoxy-2-nitrophenyl)-2,2-dimethylpropan-1-ol (CAS 1427311-76-9) is a chemical compound with the molecular formula C12H16INO4 and a molecular weight of 365.16 g/mol. IUPAC name: (1S)-1-(4-iodo-5-methoxy-2-nitrophenyl)-2,2-dimethylpropan-1-ol. InChIKey: ZLADVZVZFILTLD-LLVKDONJSA-N.
| Molecular formula | C12H16INO4 |
|---|---|
| Molecular weight | 365.16 g/mol |
| IUPAC name | (1S)-1-(4-iodo-5-methoxy-2-nitrophenyl)-2,2-dimethylpropan-1-ol |
| InChIKey | ZLADVZVZFILTLD-LLVKDONJSA-N |
| SMILES | CC(C)(C)[C@@H](C1=CC(=C(C=C1[N+](=O)[O-])I)OC)O |
Computed by PubChem (NCBI)