Products 363-73-5

CAS 363-73-5 is the registry number for 2,3,4,6-Tetrafluoroaniline, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2,3,4,6-tetrafluoroaniline (CAS 363-73-5) is a chemical compound with the molecular formula C6H3F4N and a molecular weight of 165.09 g/mol. IUPAC name: 2,3,4,6-tetrafluoroaniline. InChIKey: SBYRHTZJKKWEMP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3F4N
Molecular weight165.09 g/mol
IUPAC name2,3,4,6-tetrafluoroaniline
InChIKeySBYRHTZJKKWEMP-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1F)F)F)N)F

Computed by PubChem (NCBI)