Products 36305-60-9

CAS 36305-60-9 is the registry number for 6-Chloro-2,3-diphenylquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

6-chloro-2,3-diphenylquinoxaline (CAS 36305-60-9) is a chemical compound with the molecular formula C20H13ClN2 and a molecular weight of 316.8 g/mol. IUPAC name: 6-chloro-2,3-diphenylquinoxaline. InChIKey: ORPBDLVVKYEJNL-UHFFFAOYSA-N.

Identity
Molecular formulaC20H13ClN2
Molecular weight316.8 g/mol
IUPAC name6-chloro-2,3-diphenylquinoxaline
InChIKeyORPBDLVVKYEJNL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Cl)N=C2C4=CC=CC=C4

Computed by PubChem (NCBI)