CAS 363134-99-0 appears in our catalog under these names: (2S,3S,4R)-2-(BROMOMETHYL)-3,4-DIHYDRO-2H-PYRAN-3,4-DIYL DIACETATE, 95%, 95%, D-arabino-Hex-1-enitol, 1,5-anhydro-6-bromo-2,6-dideoxy-, diacetate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(2S,3S,4R)-3-acetyloxy-2-(bromomethyl)-3,4-dihydro-2H-pyran-4-yl] acetate (CAS 363134-99-0) is a chemical compound with the molecular formula C10H13BrO5 and a molecular weight of 293.11 g/mol. IUPAC name: [(2S,3S,4R)-3-acetyloxy-2-(bromomethyl)-3,4-dihydro-2H-pyran-4-yl] acetate. InChIKey: DQNFCLGVUNVEDP-BBBLOLIVSA-N.
| Molecular formula | C10H13BrO5 |
|---|---|
| Molecular weight | 293.11 g/mol |
| IUPAC name | [(2S,3S,4R)-3-acetyloxy-2-(bromomethyl)-3,4-dihydro-2H-pyran-4-yl] acetate |
| InChIKey | DQNFCLGVUNVEDP-BBBLOLIVSA-N |
| SMILES | CC(=O)O[C@@H]1C=CO[C@@H]([C@H]1OC(=O)C)CBr |
Computed by PubChem (NCBI)