CAS 363610-34-8 appears in our catalog under these names: Oxyphyllenone A, Oxyphyllenone A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(4aR,7R,8R)-7,8-dihydroxy-4a,8-dimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one (CAS 363610-34-8) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. IUPAC name: (4aR,7R,8R)-7,8-dihydroxy-4a,8-dimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one. InChIKey: ORLGUEREMYIFNG-GRYCIOLGSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (4aR,7R,8R)-7,8-dihydroxy-4a,8-dimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one |
| InChIKey | ORLGUEREMYIFNG-GRYCIOLGSA-N |
| SMILES | C[C@]12CC[C@H]([C@](C1=CC(=O)CC2)(C)O)O |
Computed by PubChem (NCBI)