CAS 36389-16-9 is the registry number for 5-Fluorobenzofuroxan, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-1-oxido-2,1,3-benzoxadiazol-1-ium (CAS 36389-16-9) is a chemical compound with the molecular formula C6H3FN2O2 and a molecular weight of 154.10 g/mol. IUPAC name: 5-fluoro-1-oxido-2,1,3-benzoxadiazol-1-ium. InChIKey: QGJICKKZZHDRBX-UHFFFAOYSA-N.
| Molecular formula | C6H3FN2O2 |
|---|---|
| Molecular weight | 154.10 g/mol |
| IUPAC name | 5-fluoro-1-oxido-2,1,3-benzoxadiazol-1-ium |
| InChIKey | QGJICKKZZHDRBX-UHFFFAOYSA-N |
| SMILES | C1=CC2=[N+](ON=C2C=C1F)[O-] |
Computed by PubChem (NCBI)