CAS 36396-99-3 appears in our catalog under these names: N6-Cyclohexyladenosine, 99%, 99%, N6-Cyclohexyladenosine, >95% (HPLC), N6-Cyclohexyladenosine/ 98.31% (existing batch purity), N6-Cyclohexyladenosine 98%, N6-Cyclohexyladenosine, 99.98%. Offered by: Chemat, TRC, TargetMol, Ambeed, MedChemExpress. Available pack sizes: 100mg, 250mg, 10mg, 50mg, 25mg, 200mg, 1g, 10mM/1mL.
(3R,4S)-2-[6-(cyclohexylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 36396-99-3) is a chemical compound with the molecular formula C16H23N5O4 and a molecular weight of 349.38 g/mol. IUPAC name: (3R,4S)-2-[6-(cyclohexylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: SZBULDQSDUXAPJ-WXURJZIFSA-N.
| Molecular formula | C16H23N5O4 |
|---|---|
| Molecular weight | 349.38 g/mol |
| IUPAC name | (3R,4S)-2-[6-(cyclohexylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | SZBULDQSDUXAPJ-WXURJZIFSA-N |
| SMILES | C1CCC(CC1)NC2=C3C(=NC=N2)N(C=N3)C4[C@@H]([C@@H](C(O4)CO)O)O |
Computed by PubChem (NCBI)