CAS 36397-14-5 is the registry number for 3-Methoxymorphinan Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
(1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride (CAS 36397-14-5) is a chemical compound with the molecular formula C17H24ClNO and a molecular weight of 293.8 g/mol. IUPAC name: (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride. InChIKey: IBNAJETZECTKHN-DYWKTHLTSA-N.
| Molecular formula | C17H24ClNO |
|---|---|
| Molecular weight | 293.8 g/mol |
| IUPAC name | (1R,9R,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride |
| InChIKey | IBNAJETZECTKHN-DYWKTHLTSA-N |
| SMILES | COC1=CC2=C(C[C@@H]3[C@H]4[C@@]2(CCCC4)CCN3)C=C1.Cl |
Computed by PubChem (NCBI)