CAS 364-96-5 is the registry number for Hydrochlorothiazide Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 364-96-5) is a chemical compound with the molecular formula C8H6Cl2N2O2S and a molecular weight of 265.12 g/mol. IUPAC name: 6,7-dichloro-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: NJMWRGDFOPSHPX-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O2S |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | 6,7-dichloro-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | NJMWRGDFOPSHPX-UHFFFAOYSA-N |
| SMILES | CC1=NS(=O)(=O)C2=CC(=C(C=C2N1)Cl)Cl |
Computed by PubChem (NCBI)