CAS 36402-77-4 appears in our catalog under these names: Benzyl orange, 95%, Benzyl Orange, Benzyl Orange, Benzylorange, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 200mg.
Sodium 4-[[4-(benzylamino)phenyl]diazenyl]benzenesulfonate (CAS 36402-77-4) is a chemical compound with the molecular formula C19H16N3NaO3S and a molecular weight of 389.4 g/mol. IUPAC name: sodium 4-[[4-(benzylamino)phenyl]diazenyl]benzenesulfonate. InChIKey: JGCBNZLRTUKUAQ-UHFFFAOYSA-M.
| Molecular formula | C19H16N3NaO3S |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | sodium 4-[[4-(benzylamino)phenyl]diazenyl]benzenesulfonate |
| InChIKey | JGCBNZLRTUKUAQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CNC2=CC=C(C=C2)N=NC3=CC=C(C=C3)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)