CAS 36403-90-4 appears in our catalog under these names: 9(R)–Hexahydrocannabinol, 9(R)–Hexahydrocannabinol (CRM). Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(6aR,9R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol (CAS 36403-90-4) is a chemical compound with the molecular formula C21H32O2 and a molecular weight of 316.5 g/mol. IUPAC name: (6aR,9R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol. InChIKey: XKRHRBJLCLXSGE-DJIMGWMZSA-N.
| Molecular formula | C21H32O2 |
|---|---|
| Molecular weight | 316.5 g/mol |
| IUPAC name | (6aR,9R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
| InChIKey | XKRHRBJLCLXSGE-DJIMGWMZSA-N |
| SMILES | CCCCCC1=CC(=C2[C@@H]3C[C@@H](CC[C@H]3C(OC2=C1)(C)C)C)O |
Computed by PubChem (NCBI)