CAS 364047-51-8 appears in our catalog under these names: Hptu, 98%, 1,1,3,3–Tetramethyl–2–(2–oxopyridin–1(2H)–yl)isouronium hexafluorophosphate, HPTU, HPTU 98%, HPTU, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 1kg, 2g.
[dimethylamino-[(2-oxo-1-pyridinyl)oxy]methylidene]-dimethylazanium hexafluorophosphate (CAS 364047-51-8) is a chemical compound with the molecular formula C10H16F6N3O2P and a molecular weight of 355.22 g/mol. IUPAC name: [dimethylamino-[(2-oxo-1-pyridinyl)oxy]methylidene]-dimethylazanium hexafluorophosphate. InChIKey: OVOWPFZLWCWFQE-UHFFFAOYSA-N.
| Molecular formula | C10H16F6N3O2P |
|---|---|
| Molecular weight | 355.22 g/mol |
| IUPAC name | [dimethylamino-[(2-oxo-1-pyridinyl)oxy]methylidene]-dimethylazanium hexafluorophosphate |
| InChIKey | OVOWPFZLWCWFQE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=[N+](C)C)ON1C=CC=CC1=O.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)