CAS 36422-63-6 is the registry number for (E)-1,2-Bis(4-(benzo[d]oxazol-2-yl)phenyl)ethene 98%. Offered by: Ambeed. Available pack sizes: 100g, 500g.
2-[4-[(E)-2-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole (CAS 36422-63-6) is a chemical compound with the molecular formula C28H18N2O2 and a molecular weight of 414.5 g/mol. IUPAC name: 2-[4-[(E)-2-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole. InChIKey: ORACIQIJMCYPHQ-MDZDMXLPSA-N.
| Molecular formula | C28H18N2O2 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 2-[4-[(E)-2-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole |
| InChIKey | ORACIQIJMCYPHQ-MDZDMXLPSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC=C(C=C3)/C=C/C4=CC=C(C=C4)C5=NC6=CC=CC=C6O5 |
Computed by PubChem (NCBI)