CAS 3643-70-7 is the registry number for Cyclic Diphosphorochloridite Pentaerythritol. Offered by: TRC. Available pack sizes: 250mg.
3,9-dichloro-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (CAS 3643-70-7) is a chemical compound with the molecular formula C5H8Cl2O4P2 and a molecular weight of 264.96 g/mol. IUPAC name: 3,9-dichloro-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane. InChIKey: KHUMEUDRBMWIBR-UHFFFAOYSA-N.
| Molecular formula | C5H8Cl2O4P2 |
|---|---|
| Molecular weight | 264.96 g/mol |
| IUPAC name | 3,9-dichloro-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| InChIKey | KHUMEUDRBMWIBR-UHFFFAOYSA-N |
| SMILES | C1C2(COP(O1)Cl)COP(OC2)Cl |
Computed by PubChem (NCBI)