CAS 364333-02-8 appears in our catalog under these names: 4,9–Dibromonaphtho(2,3–c)(1,2,5)selenadiazole, 4,9-Dibromonaphtho[2,3-c][1,2,5]selenadiazole, 95%, 95%, 4,9-Dibromonaphtho[2,3-c][1,2,5]selenadiazole, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4,9-dibromobenzo[f][2,1,3]benzoselenadiazole (CAS 364333-02-8) is a chemical compound with the molecular formula C10H4Br2N2Se and a molecular weight of 390.93 g/mol. IUPAC name: 4,9-dibromobenzo[f][2,1,3]benzoselenadiazole. InChIKey: XAQMUORMCPEMQE-UHFFFAOYSA-N.
| Molecular formula | C10H4Br2N2Se |
|---|---|
| Molecular weight | 390.93 g/mol |
| IUPAC name | 4,9-dibromobenzo[f][2,1,3]benzoselenadiazole |
| InChIKey | XAQMUORMCPEMQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=N[Se]N=C3C(=C2C=C1)Br)Br |
Computed by PubChem (NCBI)