CAS 364354-06-3 is the registry number for 2-(3-Fluoro-4-phenoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Ambeed. Available pack sizes: 1g, 100mg, 250mg.
2-(3-fluoro-4-phenoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 364354-06-3) is a chemical compound with the molecular formula C18H20BFO3 and a molecular weight of 314.2 g/mol. IUPAC name: 2-(3-fluoro-4-phenoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YVRWJAFWCFQGMK-UHFFFAOYSA-N.
| Molecular formula | C18H20BFO3 |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | 2-(3-fluoro-4-phenoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YVRWJAFWCFQGMK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC3=CC=CC=C3)F |
Computed by PubChem (NCBI)