CAS 364372-16-7 appears in our catalog under these names: 5-Amino-1,2,3,3-tetramethyl-3H-indol-1-ium 4-methylbenzene-1-sulfonate, 95%, 5-Amino-1,2,3,3-tetramethyl-3H-indol-1-ium 4-methylbenzene-1-sulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-methylbenzenesulfonate;1,2,3,3-tetramethylindol-1-ium-5-amine (CAS 364372-16-7) is a chemical compound with the molecular formula C19H24N2O3S and a molecular weight of 360.5 g/mol. IUPAC name: 4-methylbenzenesulfonate;1,2,3,3-tetramethylindol-1-ium-5-amine. InChIKey: ZZYWOGMXNMOJFL-UHFFFAOYSA-M.
| Molecular formula | C19H24N2O3S |
|---|---|
| Molecular weight | 360.5 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;1,2,3,3-tetramethylindol-1-ium-5-amine |
| InChIKey | ZZYWOGMXNMOJFL-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].CC1=[N+](C2=C(C1(C)C)C=C(C=C2)N)C |
Computed by PubChem (NCBI)