Products 36439-97-1
CAS 36439-97-1 is the registry number for Naphthalene-1,4,6-tricarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Naphthalene-1,4,6-tricarboxylic acid (CAS 36439-97-1) is a chemical compound with the molecular formula C13H8O6 and a molecular weight of 260.20 g/mol. IUPAC name: naphthalene-1,4,6-tricarboxylic acid. InChIKey: XFXIZFGSTQFTAK-UHFFFAOYSA-N.
| Molecular formula | C13H8O6 |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | naphthalene-1,4,6-tricarboxylic acid |
| InChIKey | XFXIZFGSTQFTAK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C=C1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
naphthalene-1,4,6-tricarboxylic acid