CAS 3646-61-5 appears in our catalog under these names: U-10293, Diazepam Impurity 16(U-10293), 2,8-Dichloro-6,12-diphenyldibenzo(b,f)(1,5)diazocine, >95% (HPLC), U-10293-d10. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,8-dichloro-6,12-diphenylbenzo[c][1,5]benzodiazocine (CAS 3646-61-5) is a chemical compound with the molecular formula C26H16Cl2N2 and a molecular weight of 427.3 g/mol. IUPAC name: 2,8-dichloro-6,12-diphenylbenzo[c][1,5]benzodiazocine. InChIKey: MQGFJTPZIBDFDR-UHFFFAOYSA-N.
| Molecular formula | C26H16Cl2N2 |
|---|---|
| Molecular weight | 427.3 g/mol |
| IUPAC name | 2,8-dichloro-6,12-diphenylbenzo[c][1,5]benzodiazocine |
| InChIKey | MQGFJTPZIBDFDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Cl)C(=NC4=C2C=C(C=C4)Cl)C5=CC=CC=C5 |
Computed by PubChem (NCBI)